* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-([(3-METHYL-1,2-OXAZOL-5-YL)METHYL]AMINO)ETHAN-1-OL |
English Synonyms: | 2-([(3-METHYL-1,2-OXAZOL-5-YL)METHYL]AMINO)ETHAN-1-OL |
MDL Number.: | MFCD16105047 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | Cc1cc(on1)CNCCO |
InChi: | InChI=1S/C7H12N2O2/c1-6-4-7(11-9-6)5-8-2-3-10/h4,8,10H,2-3,5H2,1H3 |
InChiKey: | InChIKey=PSVGUYVOUJYIDQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.