* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-CYANO-2,2-DIMETHYL-N-(3-METHYL-1,2-OXAZOL-5-YL)ACETAMIDE |
| English Synonyms: | 2-CYANO-2,2-DIMETHYL-N-(3-METHYL-1,2-OXAZOL-5-YL)ACETAMIDE |
| MDL Number.: | MFCD16105822 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | Cc1cc(on1)NC(=O)C(C)(C)C#N |
| InChi: | InChI=1S/C9H11N3O2/c1-6-4-7(14-12-6)11-8(13)9(2,3)5-10/h4H,1-3H3,(H,11,13) |
| InChiKey: | InChIKey=BOBVHYZTWFBRRV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.