* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-[(1-ETHOXYPROPAN-2-YL)AMINO]-1-(THIOPHEN-2-YL)ETHAN-1-OL |
English Synonyms: | 2-[(1-ETHOXYPROPAN-2-YL)AMINO]-1-(THIOPHEN-2-YL)ETHAN-1-OL |
MDL Number.: | MFCD16107176 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CCOCC(C)NCC(c1cccs1)O |
InChi: | InChI=1S/C11H19NO2S/c1-3-14-8-9(2)12-7-10(13)11-5-4-6-15-11/h4-6,9-10,12-13H,3,7-8H2,1-2H3 |
InChiKey: | InChIKey=HEANUZRUKRABKH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.