* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-BUTYL-3H-IMIDAZO[4,5-B]PYRIDINE |
| English Synonyms: | 2-BUTYL-3H-IMIDAZO[4,5-B]PYRIDINE |
| MDL Number.: | MFCD16107835 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCCCc1[nH]c2c(n1)cccn2 |
| InChi: | InChI=1S/C10H13N3/c1-2-3-6-9-12-8-5-4-7-11-10(8)13-9/h4-5,7H,2-3,6H2,1H3,(H,11,12,13) |
| InChiKey: | InChIKey=HLVIJINGDIXEEV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.