* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,5-DIMETHYL-4-OXOOCTANOIC ACID |
| English Synonyms: | 2,5-DIMETHYL-4-OXOOCTANOIC ACID |
| MDL Number.: | MFCD16151099 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCCC(C)C(=O)CC(C)C(=O)O |
| InChi: | InChI=1S/C10H18O3/c1-4-5-7(2)9(11)6-8(3)10(12)13/h7-8H,4-6H2,1-3H3,(H,12,13) |
| InChiKey: | InChIKey=JBPWHDAVUWDGMY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.