* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-METHYL-1-(5-PROPYL-1,2,4-OXADIAZOL-3-YL)PENTAN-1-AMINE |
English Synonyms: | 2-METHYL-1-(5-PROPYL-1,2,4-OXADIAZOL-3-YL)PENTAN-1-AMINE |
MDL Number.: | MFCD16151194 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCCc1nc(no1)C(C(C)CCC)N |
InChi: | InChI=1S/C11H21N3O/c1-4-6-8(3)10(12)11-13-9(7-5-2)15-14-11/h8,10H,4-7,12H2,1-3H3 |
InChiKey: | InChIKey=XMRDZLTZEYVPEY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.