* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(ETHYLAMINO)-3-METHYLHEXAN-1-OL |
English Synonyms: | 2-(ETHYLAMINO)-3-METHYLHEXAN-1-OL |
MDL Number.: | MFCD16151215 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | CCCC(C)C(CO)NCC |
InChi: | InChI=1S/C9H21NO/c1-4-6-8(3)9(7-11)10-5-2/h8-11H,4-7H2,1-3H3 |
InChiKey: | InChIKey=IOGNRBIVXFEJGY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.