* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-[4-(1,2-OXAZOL-5-YLMETHYL)PIPERAZIN-1-YL]ETHAN-1-OL |
English Synonyms: | 2-[4-(1,2-OXAZOL-5-YLMETHYL)PIPERAZIN-1-YL]ETHAN-1-OL |
MDL Number.: | MFCD16151747 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cnoc1CN2CCN(CC2)CCO |
InChi: | InChI=1S/C10H17N3O2/c14-8-7-12-3-5-13(6-4-12)9-10-1-2-11-15-10/h1-2,14H,3-9H2 |
InChiKey: | InChIKey=MWSZYZBPYLPDTE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.