* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-([(DIAMINO-1,3,5-TRIAZIN-2-YL)METHYL](ETHYL)AMINO)ETHAN-1-OL |
| English Synonyms: | 2-([(DIAMINO-1,3,5-TRIAZIN-2-YL)METHYL](ETHYL)AMINO)ETHAN-1-OL |
| MDL Number.: | MFCD16152530 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | CCN(CCO)Cc1nc(nc(n1)N)N |
| InChi: | InChI=1S/C8H16N6O/c1-2-14(3-4-15)5-6-11-7(9)13-8(10)12-6/h15H,2-5H2,1H3,(H4,9,10,11,12,13) |
| InChiKey: | InChIKey=QVLDHNLPQAOQPZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.