* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-(ETHYL[(5-METHYL-1,2-OXAZOL-3-YL)METHYL]AMINO)ETHAN-1-OL |
| English Synonyms: | 2-(ETHYL[(5-METHYL-1,2-OXAZOL-3-YL)METHYL]AMINO)ETHAN-1-OL |
| MDL Number.: | MFCD16152536 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCN(CCO)Cc1cc(on1)C |
| InChi: | InChI=1S/C9H16N2O2/c1-3-11(4-5-12)7-9-6-8(2)13-10-9/h6,12H,3-5,7H2,1-2H3 |
| InChiKey: | InChIKey=YLRCSKVTEROIFR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.