* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-([(5-METHYL-1,2-OXAZOL-3-YL)METHYL](PROPAN-2-YL)AMINO)ETHAN-1-OL |
English Synonyms: | 2-([(5-METHYL-1,2-OXAZOL-3-YL)METHYL](PROPAN-2-YL)AMINO)ETHAN-1-OL |
MDL Number.: | MFCD16153015 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1cc(no1)CN(CCO)C(C)C |
InChi: | InChI=1S/C10H18N2O2/c1-8(2)12(4-5-13)7-10-6-9(3)14-11-10/h6,8,13H,4-5,7H2,1-3H3 |
InChiKey: | InChIKey=DNIGCYGCTHKVHL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.