* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-CHLORO-1-N-[1-(2H-1,2,3,4-TETRAZOL-5-YL)ETHYL]BENZENE-1,4-DIAMINE |
| English Synonyms: | 2-CHLORO-1-N-[1-(2H-1,2,3,4-TETRAZOL-5-YL)ETHYL]BENZENE-1,4-DIAMINE |
| MDL Number.: | MFCD16155626 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | CC(c1n[nH]nn1)Nc2ccc(cc2Cl)N |
| InChi: | InChI=1S/C9H11ClN6/c1-5(9-13-15-16-14-9)12-8-3-2-6(11)4-7(8)10/h2-5,12H,11H2,1H3,(H,13,14,15,16) |
| InChiKey: | InChIKey=CKEONUMTJWHMAF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.