* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-N-[(3-METHYL-1,2-OXAZOL-5-YL)METHYL]PYRIDINE-2,3-DIAMINE |
English Synonyms: | 2-N-[(3-METHYL-1,2-OXAZOL-5-YL)METHYL]PYRIDINE-2,3-DIAMINE |
MDL Number.: | MFCD16155657 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | Cc1cc(on1)CNc2c(cccn2)N |
InChi: | InChI=1S/C10H12N4O/c1-7-5-8(15-14-7)6-13-10-9(11)3-2-4-12-10/h2-5H,6,11H2,1H3,(H,12,13) |
InChiKey: | InChIKey=DZYWRVIBTVPKGY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.