* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(3-BROMOPHENYL)-N-(PROP-2-YN-1-YL)ACETAMIDE |
English Synonyms: | 2-(3-BROMOPHENYL)-N-(PROP-2-YN-1-YL)ACETAMIDE |
MDL Number.: | MFCD16159456 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C#CCNC(=O)Cc1cccc(c1)Br |
InChi: | InChI=1S/C11H10BrNO/c1-2-6-13-11(14)8-9-4-3-5-10(12)7-9/h1,3-5,7H,6,8H2,(H,13,14) |
InChiKey: | InChIKey=DKXWEMGOVFXBRC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.