* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-[(2-CHLOROPROP-2-EN-1-YL)(PROPAN-2-YL)AMINO]PROPAN-1-OL |
English Synonyms: | 3-[(2-CHLOROPROP-2-EN-1-YL)(PROPAN-2-YL)AMINO]PROPAN-1-OL |
MDL Number.: | MFCD16163034 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC(C)N(CCCO)CC(=C)Cl |
InChi: | InChI=1S/C9H18ClNO/c1-8(2)11(5-4-6-12)7-9(3)10/h8,12H,3-7H2,1-2H3 |
InChiKey: | InChIKey=LCBAURJHFJUNLH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.