* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-([(5-METHYL-1,2,4-OXADIAZOL-3-YL)METHYL](PROPAN-2-YL)AMINO)PROPAN-1-OL |
| English Synonyms: | 3-([(5-METHYL-1,2,4-OXADIAZOL-3-YL)METHYL](PROPAN-2-YL)AMINO)PROPAN-1-OL |
| MDL Number.: | MFCD16163046 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | Cc1nc(no1)CN(CCCO)C(C)C |
| InChi: | InChI=1S/C10H19N3O2/c1-8(2)13(5-4-6-14)7-10-11-9(3)15-12-10/h8,14H,4-7H2,1-3H3 |
| InChiKey: | InChIKey=HPXHIDSBBBHFNM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.