* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-([(3-METHYL-1,2-OXAZOL-5-YL)METHYL](PROPAN-2-YL)AMINO)PROPAN-1-OL |
| English Synonyms: | 3-([(3-METHYL-1,2-OXAZOL-5-YL)METHYL](PROPAN-2-YL)AMINO)PROPAN-1-OL |
| MDL Number.: | MFCD16163052 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cc1cc(on1)CN(CCCO)C(C)C |
| InChi: | InChI=1S/C11H20N2O2/c1-9(2)13(5-4-6-14)8-11-7-10(3)12-15-11/h7,9,14H,4-6,8H2,1-3H3 |
| InChiKey: | InChIKey=JBJHKESUNFSTGY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.