* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-(4-OXOPENTYL)-3H,4H-THIENO[2,3-D]PYRIMIDIN-4-ONE |
English Synonyms: | 3-(4-OXOPENTYL)-3H,4H-THIENO[2,3-D]PYRIMIDIN-4-ONE |
MDL Number.: | MFCD16164059 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CC(=O)CCCn1cnc2c(c1=O)ccs2 |
InChi: | InChI=1S/C11H12N2O2S/c1-8(14)3-2-5-13-7-12-10-9(11(13)15)4-6-16-10/h4,6-7H,2-3,5H2,1H3 |
InChiKey: | InChIKey=YNFRXSMCTVFBHI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.