* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-(2-OXOPROPYL)-1,3-THIAZOLIDIN-2-ONE |
English Synonyms: | 3-(2-OXOPROPYL)-1,3-THIAZOLIDIN-2-ONE |
MDL Number.: | MFCD16164285 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CC(=O)CN1CCSC1=O |
InChi: | InChI=1S/C6H9NO2S/c1-5(8)4-7-2-3-10-6(7)9/h2-4H2,1H3 |
InChiKey: | InChIKey=ROMGFUIQDIFIDT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.