* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-[2-(1-METHYL-1H-PYRROL-3-YL)-2-OXOETHYL]-1,3-THIAZOLIDIN-2-ONE |
English Synonyms: | 3-[2-(1-METHYL-1H-PYRROL-3-YL)-2-OXOETHYL]-1,3-THIAZOLIDIN-2-ONE |
MDL Number.: | MFCD16164303 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | Cn1ccc(c1)C(=O)CN2CCSC2=O |
InChi: | InChI=1S/C10H12N2O2S/c1-11-3-2-8(6-11)9(13)7-12-4-5-15-10(12)14/h2-3,6H,4-5,7H2,1H3 |
InChiKey: | InChIKey=YETIZHRHLIPQHF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.