* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-[2-(PROP-2-EN-1-YL)PHENOXY]BUTAN-2-ONE |
English Synonyms: | 3-[2-(PROP-2-EN-1-YL)PHENOXY]BUTAN-2-ONE |
MDL Number.: | MFCD16165928 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC(C(=O)C)Oc1ccccc1CC=C |
InChi: | InChI=1S/C13H16O2/c1-4-7-12-8-5-6-9-13(12)15-11(3)10(2)14/h4-6,8-9,11H,1,7H2,2-3H3 |
InChiKey: | InChIKey=ZJXYFQCORTURGZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.