* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-(2-AMINOBUTYL)-2,3-DIHYDRO-1,3-BENZOXAZOL-2-ONE |
English Synonyms: | 3-(2-AMINOBUTYL)-2,3-DIHYDRO-1,3-BENZOXAZOL-2-ONE |
MDL Number.: | MFCD16166644 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCC(Cn1c2ccccc2oc1=O)N |
InChi: | InChI=1S/C11H14N2O2/c1-2-8(12)7-13-9-5-3-4-6-10(9)15-11(13)14/h3-6,8H,2,7,12H2,1H3 |
InChiKey: | InChIKey=KUYKXSZTGRADJQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.