* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(2-OXOBUTYL)-1,3-THIAZOLIDINE-2,4-DIONE |
| English Synonyms: | 3-(2-OXOBUTYL)-1,3-THIAZOLIDINE-2,4-DIONE |
| MDL Number.: | MFCD16166801 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CCC(=O)CN1C(=O)CSC1=O |
| InChi: | InChI=1S/C7H9NO3S/c1-2-5(9)3-8-6(10)4-12-7(8)11/h2-4H2,1H3 |
| InChiKey: | InChIKey=GDEABBDJHSCUDI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.