* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(2-OXOBUTYL)-3H,4H-THIENO[2,3-D]PYRIMIDIN-4-ONE |
| English Synonyms: | 3-(2-OXOBUTYL)-3H,4H-THIENO[2,3-D]PYRIMIDIN-4-ONE |
| MDL Number.: | MFCD16166822 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CCC(=O)Cn1cnc2c(c1=O)ccs2 |
| InChi: | InChI=1S/C10H10N2O2S/c1-2-7(13)5-12-6-11-9-8(10(12)14)3-4-15-9/h3-4,6H,2,5H2,1H3 |
| InChiKey: | InChIKey=IVROKXTURQZMTJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.