* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-(2-OXOPENTYL)-1,3-OXAZOLIDIN-2-ONE |
English Synonyms: | 3-(2-OXOPENTYL)-1,3-OXAZOLIDIN-2-ONE |
MDL Number.: | MFCD16168007 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CCCC(=O)CN1CCOC1=O |
InChi: | InChI=1S/C8H13NO3/c1-2-3-7(10)6-9-4-5-12-8(9)11/h2-6H2,1H3 |
InChiKey: | InChIKey=LUUBBKJXHYHQPV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.