* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(4-PROPYL-1,3-THIAZOL-2-YL)PHENOL |
| English Synonyms: | 3-(4-PROPYL-1,3-THIAZOL-2-YL)PHENOL |
| MDL Number.: | MFCD16168681 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCCc1csc(n1)c2cccc(c2)O |
| InChi: | InChI=1S/C12H13NOS/c1-2-4-10-8-15-12(13-10)9-5-3-6-11(14)7-9/h3,5-8,14H,2,4H2,1H3 |
| InChiKey: | InChIKey=ZGJQVIVEXDZAKE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.