* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(2-OXO-4-PROPYL-2,3-DIHYDRO-1,3-THIAZOL-3-YL)PROPANOIC ACID |
| English Synonyms: | 3-(2-OXO-4-PROPYL-2,3-DIHYDRO-1,3-THIAZOL-3-YL)PROPANOIC ACID |
| MDL Number.: | MFCD16168686 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCCc1csc(=O)n1CCC(=O)O |
| InChi: | InChI=1S/C9H13NO3S/c1-2-3-7-6-14-9(13)10(7)5-4-8(11)12/h6H,2-5H2,1H3,(H,11,12) |
| InChiKey: | InChIKey=GYKDUWZRQIQKHU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.