* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(5-PROPYL-1H-IMIDAZOL-2-YL)PROPAN-1-AMINE |
| English Synonyms: | 3-(5-PROPYL-1H-IMIDAZOL-2-YL)PROPAN-1-AMINE |
| MDL Number.: | MFCD16168693 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | C(CC)C1=CN=C(N1)CCCN |
| InChi: | InChI=1S/C9H17N3/c1-2-4-8-7-11-9(12-8)5-3-6-10/h7H,2-6,10H2,1H3,(H,11,12) |
| InChiKey: | InChIKey=NSXDHDJVTTXMME-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.