* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-AMINO-3-(6-METHYL-[1,2,4]TRIAZOLO[4,3-B]PYRIDAZIN-3-YL)PROPAN-1-OL |
| English Synonyms: | 3-AMINO-3-(6-METHYL-[1,2,4]TRIAZOLO[4,3-B]PYRIDAZIN-3-YL)PROPAN-1-OL |
| MDL Number.: | MFCD16169033 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | Cc1ccc2nnc(n2n1)C(CCO)N |
| InChi: | InChI=1S/C9H13N5O/c1-6-2-3-8-11-12-9(14(8)13-6)7(10)4-5-15/h2-3,7,15H,4-5,10H2,1H3 |
| InChiKey: | InChIKey=IQMRRGDUGRETGH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.