* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-(6-METHYL-[1,2,4]TRIAZOLO[4,3-B]PYRIDAZIN-3-YL)PIPERIDINE |
English Synonyms: | 3-(6-METHYL-[1,2,4]TRIAZOLO[4,3-B]PYRIDAZIN-3-YL)PIPERIDINE |
MDL Number.: | MFCD16169056 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cc1ccc2nnc(n2n1)C3CCCNC3 |
InChi: | InChI=1S/C11H15N5/c1-8-4-5-10-13-14-11(16(10)15-8)9-3-2-6-12-7-9/h4-5,9,12H,2-3,6-7H2,1H3 |
InChiKey: | InChIKey=YTVNYIYQELVQSB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.