* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-(7-METHYL-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-YL)THIOPHEN-2-AMINE |
English Synonyms: | 3-(7-METHYL-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-YL)THIOPHEN-2-AMINE |
MDL Number.: | MFCD16169074 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cc1cc2nnc(n2cn1)c3ccsc3N |
InChi: | InChI=1S/C10H9N5S/c1-6-4-8-13-14-10(15(8)5-12-6)7-2-3-16-9(7)11/h2-5H,11H2,1H3 |
InChiKey: | InChIKey=INLVHJSOIOZGKD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.