* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-METHYL-2-([1,2,4]TRIAZOLO[3,4-F]PYRIDAZIN-6-YL)-1H-PYRAZOL-5-AMINE |
English Synonyms: | 3-METHYL-2-([1,2,4]TRIAZOLO[3,4-F]PYRIDAZIN-6-YL)-1H-PYRAZOL-5-AMINE |
MDL Number.: | MFCD16170955 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | Cc1cc(nn1c2ccc3nncn3n2)N |
InChi: | InChI=1S/C9H9N7/c1-6-4-7(10)13-16(6)9-3-2-8-12-11-5-15(8)14-9/h2-5H,1H3,(H2,10,13) |
InChiKey: | InChIKey=IFSCKPWMNRZIME-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.