* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(3-OXO-1,3-DIHYDRO-INDAZOL-2-YL)-PROPIONIC ACID |
| English Synonyms: | 3-(3-OXO-1,3-DIHYDRO-INDAZOL-2-YL)-PROPIONIC ACID |
| MDL Number.: | MFCD16171060 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1ccc2c(c1)c(=O)n([nH]2)CCC(=O)O |
| InChi: | InChI=1S/C10H10N2O3/c13-9(14)5-6-12-10(15)7-3-1-2-4-8(7)11-12/h1-4,11H,5-6H2,(H,13,14) |
| InChiKey: | InChIKey=UAVLUKXNAUQLEF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.