* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-METHYL-1-N-[1-(1H-PYRAZOL-1-YL)PROPAN-2-YL]BENZENE-1,4-DIAMINE |
English Synonyms: | 3-METHYL-1-N-[1-(1H-PYRAZOL-1-YL)PROPAN-2-YL]BENZENE-1,4-DIAMINE |
MDL Number.: | MFCD16176509 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | Cc1cc(ccc1N)NC(C)Cn2cccn2 |
InChi: | InChI=1S/C13H18N4/c1-10-8-12(4-5-13(10)14)16-11(2)9-17-7-3-6-15-17/h3-8,11,16H,9,14H2,1-2H3 |
InChiKey: | InChIKey=JWNNRLLREIJBSA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.