* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-FLUORO-1-N-[1-(1H-PYRAZOL-1-YL)PROPAN-2-YL]BENZENE-1,2-DIAMINE |
| English Synonyms: | 3-FLUORO-1-N-[1-(1H-PYRAZOL-1-YL)PROPAN-2-YL]BENZENE-1,2-DIAMINE |
| MDL Number.: | MFCD16176516 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CC(Cn1cccn1)Nc2cccc(c2N)F |
| InChi: | InChI=1S/C12H15FN4/c1-9(8-17-7-3-6-15-17)16-11-5-2-4-10(13)12(11)14/h2-7,9,16H,8,14H2,1H3 |
| InChiKey: | InChIKey=DPAHKNHWSXEXOU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.