* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-([2-(THIOPHEN-3-YL)ETHYL]AMINO)-2,3-DIHYDRO-1H-INDOL-2-ONE |
English Synonyms: | 3-([2-(THIOPHEN-3-YL)ETHYL]AMINO)-2,3-DIHYDRO-1H-INDOL-2-ONE |
MDL Number.: | MFCD16180991 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | S1C=C(C=C1)CCNC1C(NC2=CC=CC=C12)=O |
InChi: | InChI=1S/C14H14N2OS/c17-14-13(11-3-1-2-4-12(11)16-14)15-7-5-10-6-8-18-9-10/h1-4,6,8-9,13,15H,5,7H2,(H,16,17) |
InChiKey: | InChIKey=KLTCHXCDCBLKIC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.