* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-AMINO-N-[4-(PROPAN-2-YL)-1,3-THIAZOL-2-YL]-1H-PYRAZOLE-4-SULFONAMIDE |
| English Synonyms: | 3-AMINO-N-[4-(PROPAN-2-YL)-1,3-THIAZOL-2-YL]-1H-PYRAZOLE-4-SULFONAMIDE |
| MDL Number.: | MFCD16183014 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | CC(C)c1csc(n1)NS(=O)(=O)c2c[nH]nc2N |
| InChi: | InChI=1S/C9H13N5O2S2/c1-5(2)6-4-17-9(12-6)14-18(15,16)7-3-11-13-8(7)10/h3-5H,1-2H3,(H,12,14)(H3,10,11,13) |
| InChiKey: | InChIKey=PADABBRALOLXDZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.