* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-(2-CHLOROPROPANOYL)-1-[4-(PROPAN-2-YL)-1,3-THIAZOL-2-YL]UREA |
English Synonyms: | 3-(2-CHLOROPROPANOYL)-1-[4-(PROPAN-2-YL)-1,3-THIAZOL-2-YL]UREA |
MDL Number.: | MFCD16183463 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CC(C)c1csc(n1)NC(=O)NC(=O)C(C)Cl |
InChi: | InChI=1S/C10H14ClN3O2S/c1-5(2)7-4-17-10(12-7)14-9(16)13-8(15)6(3)11/h4-6H,1-3H3,(H2,12,13,14,15,16) |
InChiKey: | InChIKey=GVJZTJDBIDIRAY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.