* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-[(2-PROPYL-1,3-THIAZOL-4-YL)METHOXY]PHENOL |
English Synonyms: | 3-[(2-PROPYL-1,3-THIAZOL-4-YL)METHOXY]PHENOL |
MDL Number.: | MFCD16184858 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCCc1nc(cs1)COc2cccc(c2)O |
InChi: | InChI=1S/C13H15NO2S/c1-2-4-13-14-10(9-17-13)8-16-12-6-3-5-11(15)7-12/h3,5-7,9,15H,2,4,8H2,1H3 |
InChiKey: | InChIKey=LJDBBGJEWKOBEZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.