* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(1,4-DIAZEPAN-1-YL)-2-(2,5-DIMETHYLPHENYL)ETHAN-1-OL |
English Synonyms: | 2-(1,4-DIAZEPAN-1-YL)-2-(2,5-DIMETHYLPHENYL)ETHAN-1-OL |
MDL Number.: | MFCD16204245 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | Cc1ccc(c(c1)C(CO)N2CCCNCC2)C |
InChi: | InChI=1S/C15H24N2O/c1-12-4-5-13(2)14(10-12)15(11-18)17-8-3-6-16-7-9-17/h4-5,10,15-16,18H,3,6-9,11H2,1-2H3 |
InChiKey: | InChIKey=DPJJPFVRHRLVBP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.