* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-[(4-BROMOTHIOPHEN-2-YL)METHYL]-2H,3H-[1,2,4]TRIAZOLO[4,3-A]PYRIDIN-3-ONE |
English Synonyms: | 2-[(4-BROMOTHIOPHEN-2-YL)METHYL]-2H,3H-[1,2,4]TRIAZOLO[4,3-A]PYRIDIN-3-ONE |
MDL Number.: | MFCD16222227 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | c1ccn2c(c1)nn(c2=O)Cc3cc(cs3)Br |
InChi: | InChI=1S/C11H8BrN3OS/c12-8-5-9(17-7-8)6-15-11(16)14-4-2-1-3-10(14)13-15/h1-5,7H,6H2 |
InChiKey: | InChIKey=YSWMQDNVBOINSS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.