* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-N-(BUTAN-2-YL)-1-N-ETHYL-2-N-METHYL-2,3-DIHYDRO-1H-INDENE-1,2-DIAMINE |
English Synonyms: | 2-N-(BUTAN-2-YL)-1-N-ETHYL-2-N-METHYL-2,3-DIHYDRO-1H-INDENE-1,2-DIAMINE |
MDL Number.: | MFCD16227376 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCC(C)N(C)C1Cc2ccccc2C1NCC |
InChi: | InChI=1S/C16H26N2/c1-5-12(3)18(4)15-11-13-9-7-8-10-14(13)16(15)17-6-2/h7-10,12,15-17H,5-6,11H2,1-4H3 |
InChiKey: | InChIKey=YLVZOJTYKHQKCM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.