* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3,3-DIMETHYL-1-(2,3,5-TRIMETHYLPHENOXY)BUTAN-2-OL |
English Synonyms: | 3,3-DIMETHYL-1-(2,3,5-TRIMETHYLPHENOXY)BUTAN-2-OL |
MDL Number.: | MFCD16237602 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | Cc1cc(c(c(c1)OCC(C(C)(C)C)O)C)C |
InChi: | InChI=1S/C15H24O2/c1-10-7-11(2)12(3)13(8-10)17-9-14(16)15(4,5)6/h7-8,14,16H,9H2,1-6H3 |
InChiKey: | InChIKey=RDRSKIFYSRPQIX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.