* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-(4-METHYLPHENYL)-N-[1-(2H-1,2,3,4-TETRAZOL-5-YL)ETHYL]PROPANAMIDE |
English Synonyms: | 3-(4-METHYLPHENYL)-N-[1-(2H-1,2,3,4-TETRAZOL-5-YL)ETHYL]PROPANAMIDE |
MDL Number.: | MFCD16242940 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | Cc1ccc(cc1)CCC(=O)NC(C)c2n[nH]nn2 |
InChi: | InChI=1S/C13H17N5O/c1-9-3-5-11(6-4-9)7-8-12(19)14-10(2)13-15-17-18-16-13/h3-6,10H,7-8H2,1-2H3,(H,14,19)(H,15,16,17,18) |
InChiKey: | InChIKey=WHIDXLILPNHWHE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.