* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-METHYL-3-(PROPAN-2-YL)-1-(1H-1,2,3,4-TETRAZOL-5-YLMETHYL)PYRROLIDINE-2,5-DIONE |
English Synonyms: | 3-METHYL-3-(PROPAN-2-YL)-1-(1H-1,2,3,4-TETRAZOL-5-YLMETHYL)PYRROLIDINE-2,5-DIONE |
MDL Number.: | MFCD16243263 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CC(C)C1(CC(=O)N(C1=O)Cc2[nH]nnn2)C |
InChi: | InChI=1S/C10H15N5O2/c1-6(2)10(3)4-8(16)15(9(10)17)5-7-11-13-14-12-7/h6H,4-5H2,1-3H3,(H,11,12,13,14) |
InChiKey: | InChIKey=UETLOCFCUREOAZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.