* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ISOXAZOLO[5,4-D]PYRIMIDINE |
CAS: | 272-04-8 |
English Synonyms: | [1,2]OXAZOLO[5,4-D]PYRIMIDINE ; ISOXAZOLO[5,4-D]PYRIMIDINE |
MDL Number.: | MFCD16250038 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | c1c2cnoc2ncn1 |
InChi: | InChI=1S/C5H3N3O/c1-4-2-8-9-5(4)7-3-6-1/h1-3H |
InChiKey: | InChIKey=LGWJJQHOHBAZIF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.