* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ISOXAZOLO[5,4-F]INDOLIZINE |
| CAS: | 105583-52-6 |
| English Synonyms: | ISOXAZOLO[5,4-F]INDOLIZINE ; [1,2]OXAZOLO[5,4-F]INDOLIZINE |
| MDL Number.: | MFCD16250046 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1cc2cc3cnoc3cn2c1 |
| InChi: | InChI=1S/C9H6N2O/c1-2-8-4-7-5-10-12-9(7)6-11(8)3-1/h1-6H |
| InChiKey: | InChIKey=UBOJMPXZAPLUAD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.