Molecular Structure:
CCD No.:CCD02755848
KETOCONAZOLE-D4
Formula:C26 H24 Cl2 D4 N4 O4
MolWeight:535.462
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | KETOCONAZOLE-D4 |
| English Synonyms： | KETOCONAZOLE-D4 |
| MDL Number.： | MFCD16294714 |
| H bond acceptor： | 8 |
| H bond donor： | 0 |
| Smile： | [2H]C1(CN(CC(N1c2ccc(cc2)OC[C@H]3CO[C@](O3)(Cn4ccnc4)c5ccc(cc5Cl)Cl)([2H])[2H])C(=O)C)[2H] |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
