* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (+/-)-DELTA8-THC |
CAS: | 6087-61-2 |
English Synonyms: | (+/-)-DELTA8-THC |
MDL Number.: | MFCD16294879 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCCCc1cc(c2c(c1)OC([C@H]3[C@H]2CC(=CC3)C)(C)C)O |
InChi: | InChI=1S/C21H30O2/c1-5-6-7-8-15-12-18(22)20-16-11-14(2)9-10-17(16)21(3,4)23-19(20)13-15/h9,12-13,16-17,22H,5-8,10-11H2,1-4H3/t16-,17-/m1/s1 |
InChiKey: | InChIKey=HCAWPGARWVBULJ-IAGOWNOFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.