* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KINGSHCHEM 36577 |
| English Synonyms: | KINGSHCHEM 36577 |
| MDL Number.: | MFCD16305566 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)c1ccc2c(c1)C(CC2)CN |
| InChi: | InChI=1S/C14H21N/c1-14(2,3)12-7-6-10-4-5-11(9-15)13(10)8-12/h6-8,11H,4-5,9,15H2,1-3H3 |
| InChiKey: | InChIKey=GWAYQJRIZDXYJU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.